C36H38F2N2O4SSi — CID 67214967
(2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(2S)-5-(2,5-difluorophenyl)-2-(methoxymethoxymethyl)-2-phenyl-1,3,4-thiadiazol-3-yl]propan-1-one (PubChem CID 67214967) has the molecular formula C36H38F2N2O4SSi and a molecular weight of 660.86 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(2S)-5-(2,5-difluorophenyl)-2-(methoxymethoxymethyl)-2-phenyl-1,3,4-thiadiazol-3-yl]propan-1-one.
| Compound Name | (2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(2S)-5-(2,5-difluorophenyl)-2-(methoxymethoxymethyl)-2-phenyl-1,3,4-thiadiazol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 67214967 |
| Molecular Formula | C36H38F2N2O4SSi |
| Molecular Weight | 660.86 g/mol |
| Exact Mass | 660.23 |
| IUPAC Name | (2S)-2-[tert-butyl(diphenyl)silyl]oxy-1-[(2S)-5-(2,5-difluorophenyl)-2-(methoxymethoxymethyl)-2-phenyl-1,3,4-thiadiazol-3-yl]propan-1-one |
| SMILES | COCOC[C@]1(c2ccccc2)SC(c2cc(F)ccc2F)=NN1C(=O)[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H38F2N2O4SSi/c1-26(44-46(35(2,3)4,29-17-11-7-12-18-29)30-19-13-8-14-20-30)34(41)40-36(24-43-25-42-5,27-15-9-6-10-16-27)45-33(39-40)31-23-28(37)21-22-32(31)38/h6-23,26H,24-25H2,1-5H3/t26-,36+/m0/s1 |
| InChIKey | SHLZBEURZXAENZ-RGJYROARSA-N |
| XLogP | 6.64 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.86 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|