C27H32F3N3O7S — CID 67224700
(2R)-2-amino-5-oxo-5-[(2R)-2-phenyl-2-[[4-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]ethoxy]pentanoic acid (PubChem CID 67224700) has the molecular formula C27H32F3N3O7S and a molecular weight of 599.63 g/mol. Its IUPAC name is (2R)-2-amino-5-oxo-5-[(2R)-2-phenyl-2-[[4-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]ethoxy]pentanoic acid.
| Compound Name | (2R)-2-amino-5-oxo-5-[(2R)-2-phenyl-2-[[4-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]ethoxy]pentanoic acid |
|---|---|
| PubChem CID | 67224700 |
| Molecular Formula | C27H32F3N3O7S |
| Molecular Weight | 599.63 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | (2R)-2-amino-5-oxo-5-[(2R)-2-phenyl-2-[[4-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]ethoxy]pentanoic acid |
| SMILES | N[C@H](CCC(=O)OC[C@H](NC(=O)C1CCC(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H32F3N3O7S/c28-27(29,30)19-8-12-21(13-9-19)41(38,39)33-20-10-6-18(7-11-20)25(35)32-23(17-4-2-1-3-5-17)16-40-24(34)15-14-22(31)26(36)37/h1-5,8-9,12-13,18,20,22-23,33H,6-7,10-11,14-16,31H2,(H,32,35)(H,36,37)/t18?,20?,22-,23+/m1/s1 |
| InChIKey | FKIVXFIMVYBSGO-CVACMQSGSA-N |
| XLogP | 3.14 |
| TPSA | 164.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.63 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |