C23H25F3N2O5S — CID 58291800
(3R)-3-phenyl-3-[[4-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]propanoic acid (PubChem CID 58291800) has the molecular formula C23H25F3N2O5S and a molecular weight of 498.52 g/mol. Its IUPAC name is (3R)-3-phenyl-3-[[4-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]propanoic acid.
| Compound Name | (3R)-3-phenyl-3-[[4-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 58291800 |
| Molecular Formula | C23H25F3N2O5S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (3R)-3-phenyl-3-[[4-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]propanoic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)C1CCC(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H25F3N2O5S/c24-23(25,26)17-8-12-19(13-9-17)34(32,33)28-18-10-6-16(7-11-18)22(31)27-20(14-21(29)30)15-4-2-1-3-5-15/h1-5,8-9,12-13,16,18,20,28H,6-7,10-11,14H2,(H,27,31)(H,29,30)/t16?,18?,20-/m1/s1 |
| InChIKey | XUOQCKLFWWGZDC-OUNSHVDWSA-N |
| XLogP | 3.87 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |