C35H40F3N3O7S — CID 67224958
[(2S)-2-phenyl-2-[[4-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]ethyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 67224958) has the molecular formula C35H40F3N3O7S and a molecular weight of 703.78 g/mol. Its IUPAC name is [(2S)-2-phenyl-2-[[4-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]ethyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | [(2S)-2-phenyl-2-[[4-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]ethyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 67224958 |
| Molecular Formula | C35H40F3N3O7S |
| Molecular Weight | 703.78 g/mol |
| Exact Mass | 703.25 |
| IUPAC Name | [(2S)-2-phenyl-2-[[4-[[4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexanecarbonyl]amino]ethyl] (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)OC[C@@H](NC(=O)C1CCC(NS(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C35H40F3N3O7S/c1-23(2)31(40-34(44)48-21-24-9-5-3-6-10-24)33(43)47-22-30(25-11-7-4-8-12-25)39-32(42)26-13-17-28(18-14-26)41-49(45,46)29-19-15-27(16-20-29)35(36,37)38/h3-12,15-16,19-20,23,26,28,30-31,41H,13-14,17-18,21-22H2,1-2H3,(H,39,42)(H,40,44)/t26?,28?,30-,31+/m1/s1 |
| InChIKey | GVHAMFOFAMNIOV-GFMLZVBASA-N |
| XLogP | 5.89 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.78 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |