C14H18N2O4 — CID 67229124
2-[[2,2-di(prop-2-enoyl)piperazin-1-yl]methyl]prop-2-enoic acid (PubChem CID 67229124) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[[2,2-di(prop-2-enoyl)piperazin-1-yl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[2,2-di(prop-2-enoyl)piperazin-1-yl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67229124 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[[2,2-di(prop-2-enoyl)piperazin-1-yl]methyl]prop-2-enoic acid |
| SMILES | C=CC(=O)C1(C(=O)C=C)CNCCN1CC(=C)C(=O)O |
| InChI | InChI=1S/C14H18N2O4/c1-4-11(17)14(12(18)5-2)9-15-6-7-16(14)8-10(3)13(19)20/h4-5,15H,1-3,6-9H2,(H,19,20) |
| InChIKey | FYDSNUCVROWSNU-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|