C21H24N2O5S2 — CID 67229225
1-[1-(benzenesulfonyl)-5-methoxypyrrolo[2,3-b]pyridin-2-yl]-1-methylsulfanyl-2-(oxolan-2-yl)ethanol (PubChem CID 67229225) has the molecular formula C21H24N2O5S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)-5-methoxypyrrolo[2,3-b]pyridin-2-yl]-1-methylsulfanyl-2-(oxolan-2-yl)ethanol.
| Compound Name | 1-[1-(benzenesulfonyl)-5-methoxypyrrolo[2,3-b]pyridin-2-yl]-1-methylsulfanyl-2-(oxolan-2-yl)ethanol |
|---|---|
| PubChem CID | 67229225 |
| Molecular Formula | C21H24N2O5S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 1-[1-(benzenesulfonyl)-5-methoxypyrrolo[2,3-b]pyridin-2-yl]-1-methylsulfanyl-2-(oxolan-2-yl)ethanol |
| SMILES | COc1cnc2c(c1)cc(C(O)(CC1CCCO1)SC)n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O5S2/c1-27-17-11-15-12-19(21(24,29-2)13-16-7-6-10-28-16)23(20(15)22-14-17)30(25,26)18-8-4-3-5-9-18/h3-5,8-9,11-12,14,16,24H,6-7,10,13H2,1-2H3 |
| InChIKey | SCDFXLDFQGDEDL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|