C28H36N4O4S — CID 67230021
benzyl 5-[[4-[5-(butylamino)-1,3,4-thiadiazol-2-yl]-2,6-dimethylphenoxy]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 67230021) has the molecular formula C28H36N4O4S and a molecular weight of 524.69 g/mol. Its IUPAC name is benzyl 5-[[4-[5-(butylamino)-1,3,4-thiadiazol-2-yl]-2,6-dimethylphenoxy]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl 5-[[4-[5-(butylamino)-1,3,4-thiadiazol-2-yl]-2,6-dimethylphenoxy]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 67230021 |
| Molecular Formula | C28H36N4O4S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | benzyl 5-[[4-[5-(butylamino)-1,3,4-thiadiazol-2-yl]-2,6-dimethylphenoxy]methyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCNc1nnc(-c2cc(C)c(OCC3CN(C(=O)OCc4ccccc4)C(C)(C)O3)c(C)c2)s1 |
| InChI | InChI=1S/C28H36N4O4S/c1-6-7-13-29-26-31-30-25(37-26)22-14-19(2)24(20(3)15-22)34-18-23-16-32(28(4,5)36-23)27(33)35-17-21-11-9-8-10-12-21/h8-12,14-15,23H,6-7,13,16-18H2,1-5H3,(H,29,31) |
| InChIKey | DMHCIZRAGVOAEH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|