C31H26N6O2 — CID 67235835
4-(6-methoxy-3-pyridin-3-yl-9H-pyrido[3,4-b]indol-5-yl)-N-[2-(pyridin-2-ylamino)ethyl]benzamide (PubChem CID 67235835) has the molecular formula C31H26N6O2 and a molecular weight of 514.59 g/mol. Its IUPAC name is 4-(6-methoxy-3-pyridin-3-yl-9H-pyrido[3,4-b]indol-5-yl)-N-[2-(pyridin-2-ylamino)ethyl]benzamide.
| Compound Name | 4-(6-methoxy-3-pyridin-3-yl-9H-pyrido[3,4-b]indol-5-yl)-N-[2-(pyridin-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 67235835 |
| Molecular Formula | C31H26N6O2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 4-(6-methoxy-3-pyridin-3-yl-9H-pyrido[3,4-b]indol-5-yl)-N-[2-(pyridin-2-ylamino)ethyl]benzamide |
| SMILES | COc1ccc2[nH]c3cnc(-c4cccnc4)cc3c2c1-c1ccc(C(=O)NCCNc2ccccn2)cc1 |
| InChI | InChI=1S/C31H26N6O2/c1-39-27-12-11-24-30(23-17-25(36-19-26(23)37-24)22-5-4-13-32-18-22)29(27)20-7-9-21(10-8-20)31(38)35-16-15-34-28-6-2-3-14-33-28/h2-14,17-19,37H,15-16H2,1H3,(H,33,34)(H,35,38) |
| InChIKey | LQDDHNUWBUKZGZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|