C24H37N5O2 — CID 67242516
1-[4-[4-(2-tert-butyl-6-propylpyrimidin-4-yl)piperazin-1-yl]butyl]-4-hydroxypyridin-2-one (PubChem CID 67242516) has the molecular formula C24H37N5O2 and a molecular weight of 427.59 g/mol. Its IUPAC name is 1-[4-[4-(2-tert-butyl-6-propylpyrimidin-4-yl)piperazin-1-yl]butyl]-4-hydroxypyridin-2-one.
| Compound Name | 1-[4-[4-(2-tert-butyl-6-propylpyrimidin-4-yl)piperazin-1-yl]butyl]-4-hydroxypyridin-2-one |
|---|---|
| PubChem CID | 67242516 |
| Molecular Formula | C24H37N5O2 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | 1-[4-[4-(2-tert-butyl-6-propylpyrimidin-4-yl)piperazin-1-yl]butyl]-4-hydroxypyridin-2-one |
| SMILES | CCCc1cc(N2CCN(CCCCn3ccc(O)cc3=O)CC2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C24H37N5O2/c1-5-8-19-17-21(26-23(25-19)24(2,3)4)28-15-13-27(14-16-28)10-6-7-11-29-12-9-20(30)18-22(29)31/h9,12,17-18,30H,5-8,10-11,13-16H2,1-4H3 |
| InChIKey | OVODNMBJYKXOCN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|