C50H70F6N12O6 — CID 173066997
but-2-enedioic acid;bis(1-[4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-4-ethylpyrimidin-2-one) (PubChem CID 173066997) has the molecular formula C50H70F6N12O6 and a molecular weight of 1049.18 g/mol. Its IUPAC name is but-2-enedioic acid;bis(1-[4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-4-ethylpyrimidin-2-one).
| Compound Name | but-2-enedioic acid;bis(1-[4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-4-ethylpyrimidin-2-one) |
|---|---|
| PubChem CID | 173066997 |
| Molecular Formula | C50H70F6N12O6 |
| Molecular Weight | 1049.18 g/mol |
| Exact Mass | 1048.54 |
| IUPAC Name | but-2-enedioic acid;bis(1-[4-[4-[2-tert-butyl-6-(trifluoromethyl)pyrimidin-4-yl]piperazin-1-yl]butyl]-4-ethylpyrimidin-2-one) |
| SMILES | CCc1ccn(CCCCN2CCN(c3cc(C(F)(F)F)nc(C(C)(C)C)n3)CC2)c(=O)n1.CCc1ccn(CCCCN2CCN(c3cc(C(F)(F)F)nc(C(C)(C)C)n3)CC2)c(=O)n1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/2C23H33F3N6O.C4H4O4/c2*1-5-17-8-11-32(21(33)27-17)10-7-6-9-30-12-14-31(15-13-30)19-16-18(23(24,25)26)28-20(29-19)22(2,3)4;5-3(6)1-2-4(7)8/h2*8,11,16H,5-7,9-10,12-15H2,1-4H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | DPPRBDONKOATIB-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 208.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.18 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|