C54H84N12O8 — CID 173067012
(E)-but-2-enedioic acid;bis(1-[4-[4-(2-tert-butyl-6-propylpyrimidin-4-yl)piperazin-1-yl]butyl]-5-ethylpyrimidine-2,4-dione) (PubChem CID 173067012) has the molecular formula C54H84N12O8 and a molecular weight of 1029.34 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis(1-[4-[4-(2-tert-butyl-6-propylpyrimidin-4-yl)piperazin-1-yl]butyl]-5-ethylpyrimidine-2,4-dione).
| Compound Name | (E)-but-2-enedioic acid;bis(1-[4-[4-(2-tert-butyl-6-propylpyrimidin-4-yl)piperazin-1-yl]butyl]-5-ethylpyrimidine-2,4-dione) |
|---|---|
| PubChem CID | 173067012 |
| Molecular Formula | C54H84N12O8 |
| Molecular Weight | 1029.34 g/mol |
| Exact Mass | 1028.65 |
| IUPAC Name | (E)-but-2-enedioic acid;bis(1-[4-[4-(2-tert-butyl-6-propylpyrimidin-4-yl)piperazin-1-yl]butyl]-5-ethylpyrimidine-2,4-dione) |
| SMILES | CCCc1cc(N2CCN(CCCCn3cc(CC)c(=O)[nH]c3=O)CC2)nc(C(C)(C)C)n1.CCCc1cc(N2CCN(CCCCn3cc(CC)c(=O)[nH]c3=O)CC2)nc(C(C)(C)C)n1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C25H40N6O2.C4H4O4/c2*1-6-10-20-17-21(27-23(26-20)25(3,4)5)30-15-13-29(14-16-30)11-8-9-12-31-18-19(7-2)22(32)28-24(31)33;5-3(6)1-2-4(7)8/h2*17-18H,6-16H2,1-5H3,(H,28,32,33);1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | SCZDJNMVKLZJSB-WXXKFALUSA-N |
| XLogP | 5.19 |
| TPSA | 248.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1029.34 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|