C62H82F2N12O6 — CID 173066727
(E)-but-2-enedioic acid;bis(1-[4-[4-(2-tert-butyl-6-propylpyrimidin-4-yl)piperazin-1-yl]butyl]-4-(3-fluorophenyl)pyrimidin-2-one) (PubChem CID 173066727) has the molecular formula C62H82F2N12O6 and a molecular weight of 1129.41 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;bis(1-[4-[4-(2-tert-butyl-6-propylpyrimidin-4-yl)piperazin-1-yl]butyl]-4-(3-fluorophenyl)pyrimidin-2-one).
| Compound Name | (E)-but-2-enedioic acid;bis(1-[4-[4-(2-tert-butyl-6-propylpyrimidin-4-yl)piperazin-1-yl]butyl]-4-(3-fluorophenyl)pyrimidin-2-one) |
|---|---|
| PubChem CID | 173066727 |
| Molecular Formula | C62H82F2N12O6 |
| Molecular Weight | 1129.41 g/mol |
| Exact Mass | 1128.64 |
| IUPAC Name | (E)-but-2-enedioic acid;bis(1-[4-[4-(2-tert-butyl-6-propylpyrimidin-4-yl)piperazin-1-yl]butyl]-4-(3-fluorophenyl)pyrimidin-2-one) |
| SMILES | CCCc1cc(N2CCN(CCCCn3ccc(-c4cccc(F)c4)nc3=O)CC2)nc(C(C)(C)C)n1.CCCc1cc(N2CCN(CCCCn3ccc(-c4cccc(F)c4)nc3=O)CC2)nc(C(C)(C)C)n1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/2C29H39FN6O.C4H4O4/c2*1-5-9-24-21-26(33-27(31-24)29(2,3)4)35-18-16-34(17-19-35)13-6-7-14-36-15-12-25(32-28(36)37)22-10-8-11-23(30)20-22;5-3(6)1-2-4(7)8/h2*8,10-12,15,20-21H,5-7,9,13-14,16-19H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;;2-1+ |
| InChIKey | HNYARDRULKQWCH-WXXKFALUSA-N |
| XLogP | 9.10 |
| TPSA | 208.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1129.41 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|