C17H23N3O2S2 — CID 67243652
1-(4-butylsulfanylisoquinolin-5-yl)sulfonylpyrrolidin-3-amine (PubChem CID 67243652) has the molecular formula C17H23N3O2S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 1-(4-butylsulfanylisoquinolin-5-yl)sulfonylpyrrolidin-3-amine.
| Compound Name | 1-(4-butylsulfanylisoquinolin-5-yl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 67243652 |
| Molecular Formula | C17H23N3O2S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 1-(4-butylsulfanylisoquinolin-5-yl)sulfonylpyrrolidin-3-amine |
| SMILES | CCCCSc1cncc2cccc(S(=O)(=O)N3CCC(N)C3)c12 |
| InChI | InChI=1S/C17H23N3O2S2/c1-2-3-9-23-15-11-19-10-13-5-4-6-16(17(13)15)24(21,22)20-8-7-14(18)12-20/h4-6,10-11,14H,2-3,7-9,12,18H2,1H3 |
| InChIKey | VFFZZCHUHWCXIY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|