C36H42N4O2 — CID 67272229
(2R)-N-[[4-[[(3,5-dimethyl-2-pyridinyl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-3-(hydroxymethyl)phenyl]methyl]-2-phenylbutanamide (PubChem CID 67272229) has the molecular formula C36H42N4O2 and a molecular weight of 562.76 g/mol. Its IUPAC name is (2R)-N-[[4-[[(3,5-dimethyl-2-pyridinyl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-3-(hydroxymethyl)phenyl]methyl]-2-phenylbutanamide.
| Compound Name | (2R)-N-[[4-[[(3,5-dimethyl-2-pyridinyl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-3-(hydroxymethyl)phenyl]methyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 67272229 |
| Molecular Formula | C36H42N4O2 |
| Molecular Weight | 562.76 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | (2R)-N-[[4-[[(3,5-dimethyl-2-pyridinyl)methyl-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-3-(hydroxymethyl)phenyl]methyl]-2-phenylbutanamide |
| SMILES | CCC(C(=O)NCc1ccc(CN(Cc2ncc(C)cc2C)C2CCCc3cccnc32)c(CO)c1)c1ccccc1 |
| InChI | InChI=1S/C36H42N4O2/c1-4-32(28-10-6-5-7-11-28)36(42)39-21-27-15-16-30(31(19-27)24-41)22-40(23-33-26(3)18-25(2)20-38-33)34-14-8-12-29-13-9-17-37-35(29)34/h5-7,9-11,13,15-20,32,34,41H,4,8,12,14,21-24H2,1-3H3,(H,39,42) |
| InChIKey | APHHBKPPTVFIBU-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.76 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |