C10H17NO2 — CID 67274471
3-(methoxymethyl)-4-pentyl-1,2-oxazole (PubChem CID 67274471) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-(methoxymethyl)-4-pentyl-1,2-oxazole.
| Compound Name | 3-(methoxymethyl)-4-pentyl-1,2-oxazole |
|---|---|
| PubChem CID | 67274471 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3-(methoxymethyl)-4-pentyl-1,2-oxazole |
| SMILES | CCCCCc1conc1COC |
| InChI | InChI=1S/C10H17NO2/c1-3-4-5-6-9-7-13-11-10(9)8-12-2/h7H,3-6,8H2,1-2H3 |
| InChIKey | OXPXJHZBVATDQA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|