About ethane;3-methyl-4-pentylfuran
ethane;3-methyl-4-pentylfuran (PubChem CID 143814936) has the molecular formula C16H34O
and a molecular weight of 242.45 g/mol. Its IUPAC name is ethane;3-methyl-4-pentylfuran.
Molecular Properties
| Compound Name | ethane;3-methyl-4-pentylfuran |
| PubChem CID | 143814936 |
| Molecular Formula | C16H34O |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.26 |
| IUPAC Name | ethane;3-methyl-4-pentylfuran |
| SMILES | CC.CC.CC.CCCCCc1cocc1C |
| InChI | InChI=1S/C10H16O.3C2H6/c1-3-4-5-6-10-8-11-7-9(10)2;3*1-2/h7-8H,3-6H2,1-2H3;3*1-2H3 |
| InChIKey | CBTYECMETYVJJG-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methyl-4-pentylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-4-pentylfuran?
The IUPAC name of ethane;3-methyl-4-pentylfuran (CID 143814936) is ethane;3-methyl-4-pentylfuran.
What is the SMILES notation for ethane;3-methyl-4-pentylfuran?
The canonical SMILES for ethane;3-methyl-4-pentylfuran is CC.CC.CC.CCCCCc1cocc1C.
What is the InChIKey of ethane;3-methyl-4-pentylfuran?
The InChIKey is CBTYECMETYVJJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O.3C2H6/c1-3-4-5-6-10-8-11-7-9(10)2;3*1-2/h7-8H,3-6H2,1-2H3;3*1-2H3.
What are the key properties of ethane;3-methyl-4-pentylfuran?
ethane;3-methyl-4-pentylfuran has a molecular weight of 242.45 g/mol, XLogP of 6.40, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-4-pentylfuran is sourced from PubChem (CID 143814936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).