About (2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole
(2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole (PubChem CID 67277954) has the molecular formula C27H28IN3O2
and a molecular weight of 553.44 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole.
Molecular Properties
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole |
| PubChem CID | 67277954 |
| Molecular Formula | C27H28IN3O2 |
| Molecular Weight | 553.44 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole |
| SMILES | CC(C)[C@H](N)C(=O)O.Ic1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C22H17IN2.C5H11NO2/c23-21-16-25(17-24-21)22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;1-3(2)4(6)5(7)8/h1-17H;3-4H,6H2,1-2H3,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | BGFCOAURVOAQRX-VWMHFEHESA-N |
| XLogP | 5.38 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 553.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole?
The IUPAC name of (2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole (CID 67277954) is (2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole.
What is the SMILES notation for (2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole?
The canonical SMILES for (2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole is CC(C)[C@H](N)C(=O)O.Ic1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1.
What is the InChIKey of (2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole?
The InChIKey is BGFCOAURVOAQRX-VWMHFEHESA-N. The full InChI is InChI=1S/C22H17IN2.C5H11NO2/c23-21-16-25(17-24-21)22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;1-3(2)4(6)5(7)8/h1-17H;3-4H,6H2,1-2H3,(H,7,8)/t;4-/m.0/s1.
What are the key properties of (2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole?
(2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole has a molecular weight of 553.44 g/mol, XLogP of 5.38, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-methylbutanoic acid;4-iodo-1-tritylimidazole is sourced from PubChem (CID 67277954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).