About methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate
methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate (PubChem CID 67280329) has the molecular formula C15H16BrNO5
and a molecular weight of 370.20 g/mol. Its IUPAC name is methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate.
Molecular Properties
| Compound Name | methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate |
| PubChem CID | 67280329 |
| Molecular Formula | C15H16BrNO5 |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate |
| SMILES | COC(=O)C1CCC2(CC1)OC(=O)c1nc(OC)c(Br)cc12 |
| InChI | InChI=1S/C15H16BrNO5/c1-20-12-10(16)7-9-11(17-12)14(19)22-15(9)5-3-8(4-6-15)13(18)21-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | KKGXAVVPDOKGDS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate?
The IUPAC name of methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate (CID 67280329) is methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate.
What is the SMILES notation for methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate?
The canonical SMILES for methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate is COC(=O)C1CCC2(CC1)OC(=O)c1nc(OC)c(Br)cc12.
What is the InChIKey of methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate?
The InChIKey is KKGXAVVPDOKGDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16BrNO5/c1-20-12-10(16)7-9-11(17-12)14(19)22-15(9)5-3-8(4-6-15)13(18)21-2/h7-8H,3-6H2,1-2H3.
What are the key properties of methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate?
methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate has a molecular weight of 370.20 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3'-bromo-2'-methoxy-7'-oxospiro[cyclohexane-4,5'-furo[3,4-b]pyridine]-1-carboxylate is sourced from PubChem (CID 67280329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).