C21H15BrFNO3S — CID 67300358
3-(4-bromo-3-ethoxyphenyl)-5-fluoro-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione (PubChem CID 67300358) has the molecular formula C21H15BrFNO3S and a molecular weight of 460.32 g/mol. Its IUPAC name is 3-(4-bromo-3-ethoxyphenyl)-5-fluoro-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione.
| Compound Name | 3-(4-bromo-3-ethoxyphenyl)-5-fluoro-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione |
|---|---|
| PubChem CID | 67300358 |
| Molecular Formula | C21H15BrFNO3S |
| Molecular Weight | 460.32 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | 3-(4-bromo-3-ethoxyphenyl)-5-fluoro-5-phenyl-7H-thieno[2,3-b]pyridine-4,6-dione |
| SMILES | CCOc1cc(-c2csc3c2C(=O)C(F)(c2ccccc2)C(=O)N3)ccc1Br |
| InChI | InChI=1S/C21H15BrFNO3S/c1-2-27-16-10-12(8-9-15(16)22)14-11-28-19-17(14)18(25)21(23,20(26)24-19)13-6-4-3-5-7-13/h3-11H,2H2,1H3,(H,24,26) |
| InChIKey | GVVBKVUHJULCHD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.32 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|