C19H20NO4S- — CID 67320068
5-[4-[2-[2-(sulfinatoamino)propyl]cyclopropyl]phenyl]-1,3-benzodioxole (PubChem CID 67320068) has the molecular formula C19H20NO4S- and a molecular weight of 358.44 g/mol. Its IUPAC name is 5-[4-[2-[2-(sulfinatoamino)propyl]cyclopropyl]phenyl]-1,3-benzodioxole.
| Compound Name | 5-[4-[2-[2-(sulfinatoamino)propyl]cyclopropyl]phenyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 67320068 |
| Molecular Formula | C19H20NO4S- |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 5-[4-[2-[2-(sulfinatoamino)propyl]cyclopropyl]phenyl]-1,3-benzodioxole |
| SMILES | CC(CC1CC1c1ccc(-c2ccc3c(c2)OCO3)cc1)NS(=O)[O-] |
| InChI | InChI=1S/C19H21NO4S/c1-12(20-25(21)22)8-16-9-17(16)14-4-2-13(3-5-14)15-6-7-18-19(10-15)24-11-23-18/h2-7,10,12,16-17,20H,8-9,11H2,1H3,(H,21,22)/p-1 |
| InChIKey | JIMYPVQLCOMVBB-UHFFFAOYSA-M |
| XLogP | 3.35 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|