C21H22ClF2NO4S — CID 67325355
7-(3,5-difluorophenyl)sulfonylspiro[3,4,4a,9a-tetrahydro-2H-[1]benzofuro[2,3-c]pyridine-1,4'-oxane];hydrochloride (PubChem CID 67325355) has the molecular formula C21H22ClF2NO4S and a molecular weight of 457.93 g/mol. Its IUPAC name is 7-(3,5-difluorophenyl)sulfonylspiro[3,4,4a,9a-tetrahydro-2H-[1]benzofuro[2,3-c]pyridine-1,4'-oxane];hydrochloride.
| Compound Name | 7-(3,5-difluorophenyl)sulfonylspiro[3,4,4a,9a-tetrahydro-2H-[1]benzofuro[2,3-c]pyridine-1,4'-oxane];hydrochloride |
|---|---|
| PubChem CID | 67325355 |
| Molecular Formula | C21H22ClF2NO4S |
| Molecular Weight | 457.93 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 7-(3,5-difluorophenyl)sulfonylspiro[3,4,4a,9a-tetrahydro-2H-[1]benzofuro[2,3-c]pyridine-1,4'-oxane];hydrochloride |
| SMILES | Cl.O=S(=O)(c1cc(F)cc(F)c1)c1ccc2c(c1)OC1C2CCNC12CCOCC2 |
| InChI | InChI=1S/C21H21F2NO4S.ClH/c22-13-9-14(23)11-16(10-13)29(25,26)15-1-2-17-18-3-6-24-21(4-7-27-8-5-21)20(18)28-19(17)12-15;/h1-2,9-12,18,20,24H,3-8H2;1H |
| InChIKey | XNDVRBBAVTWOCA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.93 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |