C17H15F2NO3S — CID 76535876
7-(3,5-difluorophenyl)sulfonyl-1,2,3,4,4a,9a-hexahydro-[1]benzofuro[2,3-c]pyridine (PubChem CID 76535876) has the molecular formula C17H15F2NO3S and a molecular weight of 351.37 g/mol. Its IUPAC name is 7-(3,5-difluorophenyl)sulfonyl-1,2,3,4,4a,9a-hexahydro-[1]benzofuro[2,3-c]pyridine.
| Compound Name | 7-(3,5-difluorophenyl)sulfonyl-1,2,3,4,4a,9a-hexahydro-[1]benzofuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 76535876 |
| Molecular Formula | C17H15F2NO3S |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 7-(3,5-difluorophenyl)sulfonyl-1,2,3,4,4a,9a-hexahydro-[1]benzofuro[2,3-c]pyridine |
| SMILES | O=S(=O)(c1cc(F)cc(F)c1)c1ccc2c(c1)OC1CNCCC21 |
| InChI | InChI=1S/C17H15F2NO3S/c18-10-5-11(19)7-13(6-10)24(21,22)12-1-2-14-15-3-4-20-9-17(15)23-16(14)8-12/h1-2,5-8,15,17,20H,3-4,9H2 |
| InChIKey | FECXTVAJHWAPLK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |