C17H18ClN5O2 — CID 67325681
5-[6-[(5-chloro-2-pyridinyl)amino]-2-pyridinyl]-N-(3-methoxypropyl)-1,3-oxazol-2-amine (PubChem CID 67325681) has the molecular formula C17H18ClN5O2 and a molecular weight of 359.82 g/mol. Its IUPAC name is 5-[6-[(5-chloro-2-pyridinyl)amino]-2-pyridinyl]-N-(3-methoxypropyl)-1,3-oxazol-2-amine.
| Compound Name | 5-[6-[(5-chloro-2-pyridinyl)amino]-2-pyridinyl]-N-(3-methoxypropyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 67325681 |
| Molecular Formula | C17H18ClN5O2 |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 5-[6-[(5-chloro-2-pyridinyl)amino]-2-pyridinyl]-N-(3-methoxypropyl)-1,3-oxazol-2-amine |
| SMILES | COCCCNc1ncc(-c2cccc(Nc3ccc(Cl)cn3)n2)o1 |
| InChI | InChI=1S/C17H18ClN5O2/c1-24-9-3-8-19-17-21-11-14(25-17)13-4-2-5-16(22-13)23-15-7-6-12(18)10-20-15/h2,4-7,10-11H,3,8-9H2,1H3,(H,19,21)(H,20,22,23) |
| InChIKey | CUEGBGATQLDYGZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|