C14H17N3O4S — CID 6733948
2-pyrrol-1-ylethyl N-[(4-sulfamoylphenyl)methyl]carbamate (PubChem CID 6733948) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-pyrrol-1-ylethyl N-[(4-sulfamoylphenyl)methyl]carbamate.
| Compound Name | 2-pyrrol-1-ylethyl N-[(4-sulfamoylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 6733948 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-pyrrol-1-ylethyl N-[(4-sulfamoylphenyl)methyl]carbamate |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)OCCn2cccc2)cc1 |
| InChI | InChI=1S/C14H17N3O4S/c15-22(19,20)13-5-3-12(4-6-13)11-16-14(18)21-10-9-17-7-1-2-8-17/h1-8H,9-11H2,(H,16,18)(H2,15,19,20) |
| InChIKey | HDTAEUCHOUHXST-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |