C17H24N2O4S — CID 6735198
non-2-ynyl N-[(4-sulfamoylphenyl)methyl]carbamate (PubChem CID 6735198) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is non-2-ynyl N-[(4-sulfamoylphenyl)methyl]carbamate.
| Compound Name | non-2-ynyl N-[(4-sulfamoylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 6735198 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | non-2-ynyl N-[(4-sulfamoylphenyl)methyl]carbamate |
| SMILES | CCCCCCC#CCOC(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H24N2O4S/c1-2-3-4-5-6-7-8-13-23-17(20)19-14-15-9-11-16(12-10-15)24(18,21)22/h9-12H,2-6,13-14H2,1H3,(H,19,20)(H2,18,21,22) |
| InChIKey | ZWWJZQSXCYBWDZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|