C16H27N3O4S — CID 6736715
6-(dimethylamino)hexyl N-[(4-sulfamoylphenyl)methyl]carbamate (PubChem CID 6736715) has the molecular formula C16H27N3O4S and a molecular weight of 357.48 g/mol. Its IUPAC name is 6-(dimethylamino)hexyl N-[(4-sulfamoylphenyl)methyl]carbamate.
| Compound Name | 6-(dimethylamino)hexyl N-[(4-sulfamoylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 6736715 |
| Molecular Formula | C16H27N3O4S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 6-(dimethylamino)hexyl N-[(4-sulfamoylphenyl)methyl]carbamate |
| SMILES | CN(C)CCCCCCOC(=O)NCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H27N3O4S/c1-19(2)11-5-3-4-6-12-23-16(20)18-13-14-7-9-15(10-8-14)24(17,21)22/h7-10H,3-6,11-13H2,1-2H3,(H,18,20)(H2,17,21,22) |
| InChIKey | WJGWMPJPXSPSKJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|