C25H34FN3OS — CID 67348039
2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 67348039) has the molecular formula C25H34FN3OS and a molecular weight of 443.63 g/mol. Its IUPAC name is 2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 67348039 |
| Molecular Formula | C25H34FN3OS |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CCCCN1/C(=N/C23CC4CC(CC(C4)C2)C3)SCC1CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H34FN3OS/c1-2-3-8-29-22(12-23(30)27-21-6-4-20(26)5-7-21)16-31-24(29)28-25-13-17-9-18(14-25)11-19(10-17)15-25/h4-7,17-19,22H,2-3,8-16H2,1H3,(H,27,30)/b28-24- |
| InChIKey | XNZPBXUGKBKTGX-COOPMVRXSA-N |
| XLogP | 5.70 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|