C25H33ClFN3OS — CID 67349342
2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-(4-chloro-2-fluorophenyl)acetamide (PubChem CID 67349342) has the molecular formula C25H33ClFN3OS and a molecular weight of 478.08 g/mol. Its IUPAC name is 2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-(4-chloro-2-fluorophenyl)acetamide.
| Compound Name | 2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-(4-chloro-2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 67349342 |
| Molecular Formula | C25H33ClFN3OS |
| Molecular Weight | 478.08 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 2-[2-(1-adamantylimino)-3-butyl-1,3-thiazolidin-4-yl]-N-(4-chloro-2-fluorophenyl)acetamide |
| SMILES | CCCCN1/C(=N/C23CC4CC(CC(C4)C2)C3)SCC1CC(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C25H33ClFN3OS/c1-2-3-6-30-20(11-23(31)28-22-5-4-19(26)10-21(22)27)15-32-24(30)29-25-12-16-7-17(13-25)9-18(8-16)14-25/h4-5,10,16-18,20H,2-3,6-9,11-15H2,1H3,(H,28,31)/b29-24- |
| InChIKey | YADUPSZUGWONSV-OLFWJLLRSA-N |
| XLogP | 6.35 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.08 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|