C22H28FN3OS — CID 67350834
2-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 67350834) has the molecular formula C22H28FN3OS and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 67350834 |
| Molecular Formula | C22H28FN3OS |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 2-[2-(1-adamantylimino)-3-methyl-1,3-thiazolidin-4-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CN1/C(=N/C23CC4CC(CC(C4)C2)C3)SCC1CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H28FN3OS/c1-26-19(9-20(27)24-18-4-2-17(23)3-5-18)13-28-21(26)25-22-10-14-6-15(11-22)8-16(7-14)12-22/h2-5,14-16,19H,6-13H2,1H3,(H,24,27)/b25-21- |
| InChIKey | HYEKXSOZYXZYJP-DAFNUICNSA-N |
| XLogP | 4.53 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|