C15H15N5O4 — CID 6736200
N'-(furan-2-carbonyl)-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbohydrazide (PubChem CID 6736200) has the molecular formula C15H15N5O4 and a molecular weight of 329.32 g/mol. Its IUPAC name is N'-(furan-2-carbonyl)-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbohydrazide.
| Compound Name | N'-(furan-2-carbonyl)-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbohydrazide |
|---|---|
| PubChem CID | 6736200 |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N'-(furan-2-carbonyl)-4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carbohydrazide |
| SMILES | COc1c(C(=O)NNC(=O)c2ccco2)cnc2c1c(C)nn2C |
| InChI | InChI=1S/C15H15N5O4/c1-8-11-12(23-3)9(7-16-13(11)20(2)19-8)14(21)17-18-15(22)10-5-4-6-24-10/h4-7H,1-3H3,(H,17,21)(H,18,22) |
| InChIKey | IVMXVFNLIDHYET-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 111.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|