C23H18N2O3 — CID 67364579
[1-(2-carbamoylnaphthalen-1-yl)naphthalen-2-yl]-methylcarbamic acid (PubChem CID 67364579) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is [1-(2-carbamoylnaphthalen-1-yl)naphthalen-2-yl]-methylcarbamic acid.
| Compound Name | [1-(2-carbamoylnaphthalen-1-yl)naphthalen-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 67364579 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [1-(2-carbamoylnaphthalen-1-yl)naphthalen-2-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1ccc2ccccc2c1-c1c(C(N)=O)ccc2ccccc12 |
| InChI | InChI=1S/C23H18N2O3/c1-25(23(27)28)19-13-11-15-7-3-5-9-17(15)21(19)20-16-8-4-2-6-14(16)10-12-18(20)22(24)26/h2-13H,1H3,(H2,24,26)(H,27,28) |
| InChIKey | AFYBXEJAADOJRL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |