About CID 67365757
CID 67365757 (PubChem CID 67365757) has the molecular formula C27H58O3Sn2
and a molecular weight of 668.18 g/mol.
Molecular Properties
| Compound Name | CID 67365757 |
| PubChem CID | 67365757 |
| Molecular Formula | C27H58O3Sn2 |
| Molecular Weight | 668.18 g/mol |
| Exact Mass | 670.24 |
| IUPAC Name | — |
| SMILES | CCCC[Sn](CCCC)OC(CCCC)(CCCC)CC[Sn](OCC(C)C)OCC(C)C |
| InChI | InChI=1S/C11H22O.2C4H9O.2C4H9.2Sn/c1-4-7-9-11(12,6-3)10-8-5-2;2*1-4(2)3-5;2*1-3-4-2;;/h3-10H2,1-2H3;2*4H,3H2,1-2H3;2*1,3-4H2,2H3;;/q3*-1;;;+1;+2 |
| InChIKey | PBCAWOMHZHWKBF-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 668.18 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 67365757 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67365757?
The IUPAC name of CID 67365757 (CID 67365757) is not available.
What is the SMILES notation for CID 67365757?
The canonical SMILES for CID 67365757 is CCCC[Sn](CCCC)OC(CCCC)(CCCC)CC[Sn](OCC(C)C)OCC(C)C.
What is the InChIKey of CID 67365757?
The InChIKey is PBCAWOMHZHWKBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O.2C4H9O.2C4H9.2Sn/c1-4-7-9-11(12,6-3)10-8-5-2;2*1-4(2)3-5;2*1-3-4-2;;/h3-10H2,1-2H3;2*4H,3H2,1-2H3;2*1,3-4H2,2H3;;/q3*-1;;;+1;+2.
What are the key properties of CID 67365757?
CID 67365757 has a molecular weight of 668.18 g/mol, XLogP of 8.94, 23 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67365757 is sourced from PubChem (CID 67365757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).