C27H25N3O3S — CID 6736747
[5-(2-phenylethynyl)thiophen-2-yl]methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 6736747) has the molecular formula C27H25N3O3S and a molecular weight of 471.58 g/mol. Its IUPAC name is [5-(2-phenylethynyl)thiophen-2-yl]methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | [5-(2-phenylethynyl)thiophen-2-yl]methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 6736747 |
| Molecular Formula | C27H25N3O3S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | [5-(2-phenylethynyl)thiophen-2-yl]methyl 4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C(OCc1ccc(C#Cc2ccccc2)s1)N1CCC2(CC1)C(=O)NCN2c1ccccc1 |
| InChI | InChI=1S/C27H25N3O3S/c31-25-27(30(20-28-25)22-9-5-2-6-10-22)15-17-29(18-16-27)26(32)33-19-24-14-13-23(34-24)12-11-21-7-3-1-4-8-21/h1-10,13-14H,15-20H2,(H,28,31) |
| InChIKey | WWNJTBZBJCWTFB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|