C36H38O12S — CID 67368765
4-[3-[3-(3,4-dihydroxyphenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-enyl]sulfonyl-3-(2,4,6-trimethoxyphenyl)prop-1-enyl]benzene-1,2-diol (PubChem CID 67368765) has the molecular formula C36H38O12S and a molecular weight of 694.75 g/mol. Its IUPAC name is 4-[3-[3-(3,4-dihydroxyphenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-enyl]sulfonyl-3-(2,4,6-trimethoxyphenyl)prop-1-enyl]benzene-1,2-diol.
| Compound Name | 4-[3-[3-(3,4-dihydroxyphenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-enyl]sulfonyl-3-(2,4,6-trimethoxyphenyl)prop-1-enyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 67368765 |
| Molecular Formula | C36H38O12S |
| Molecular Weight | 694.75 g/mol |
| Exact Mass | 694.21 |
| IUPAC Name | 4-[3-[3-(3,4-dihydroxyphenyl)-1-(2,4,6-trimethoxyphenyl)prop-2-enyl]sulfonyl-3-(2,4,6-trimethoxyphenyl)prop-1-enyl]benzene-1,2-diol |
| SMILES | COc1cc(OC)c(C(C=Cc2ccc(O)c(O)c2)S(=O)(=O)C(C=Cc2ccc(O)c(O)c2)c2c(OC)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C36H38O12S/c1-43-23-17-29(45-3)35(30(18-23)46-4)33(13-9-21-7-11-25(37)27(39)15-21)49(41,42)34(14-10-22-8-12-26(38)28(40)16-22)36-31(47-5)19-24(44-2)20-32(36)48-6/h7-20,33-34,37-40H,1-6H3 |
| InChIKey | YKKJLUAKIKDITC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 170.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.75 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|