C19H27NO5S — CID 67371337
tert-butyl 4-hydroxy-4-[(4-methoxycarbonylphenyl)sulfanylmethyl]piperidine-1-carboxylate (PubChem CID 67371337) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-[(4-methoxycarbonylphenyl)sulfanylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-[(4-methoxycarbonylphenyl)sulfanylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67371337 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | tert-butyl 4-hydroxy-4-[(4-methoxycarbonylphenyl)sulfanylmethyl]piperidine-1-carboxylate |
| SMILES | COC(=O)c1ccc(SCC2(O)CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H27NO5S/c1-18(2,3)25-17(22)20-11-9-19(23,10-12-20)13-26-15-7-5-14(6-8-15)16(21)24-4/h5-8,23H,9-13H2,1-4H3 |
| InChIKey | MZFGKNQDGZJEFB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |