C16H25NO4S — CID 126847754
tert-butyl 4-hydroxy-4-[(2-methylfuran-3-yl)sulfanylmethyl]piperidine-1-carboxylate (PubChem CID 126847754) has the molecular formula C16H25NO4S and a molecular weight of 327.45 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-[(2-methylfuran-3-yl)sulfanylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-[(2-methylfuran-3-yl)sulfanylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126847754 |
| Molecular Formula | C16H25NO4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | tert-butyl 4-hydroxy-4-[(2-methylfuran-3-yl)sulfanylmethyl]piperidine-1-carboxylate |
| SMILES | Cc1occc1SCC1(O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H25NO4S/c1-12-13(5-10-20-12)22-11-16(19)6-8-17(9-7-16)14(18)21-15(2,3)4/h5,10,19H,6-9,11H2,1-4H3 |
| InChIKey | YHBNKBWSVCHRIU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |