About oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate
oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate (PubChem CID 6737261) has the molecular formula C17H22N2O4
and a molecular weight of 318.37 g/mol. Its IUPAC name is oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate.
Molecular Properties
| Compound Name | oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate |
| PubChem CID | 6737261 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate |
| SMILES | CCCCCC#CCOC(=O)NNC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H22N2O4/c1-3-4-5-6-7-8-13-23-17(21)19-18-16(20)14-9-11-15(22-2)12-10-14/h9-12H,3-6,13H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | RQLXRFAOMOKCFR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate?
The IUPAC name of oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate (CID 6737261) is oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate.
What is the SMILES notation for oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate?
The canonical SMILES for oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate is CCCCCC#CCOC(=O)NNC(=O)c1ccc(OC)cc1.
What is the InChIKey of oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate?
The InChIKey is RQLXRFAOMOKCFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O4/c1-3-4-5-6-7-8-13-23-17(21)19-18-16(20)14-9-11-15(22-2)12-10-14/h9-12H,3-6,13H2,1-2H3,(H,18,20)(H,19,21).
What are the key properties of oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate?
oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate has a molecular weight of 318.37 g/mol, XLogP of 2.65, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oct-2-ynyl N-[(4-methoxybenzoyl)amino]carbamate is sourced from PubChem (CID 6737261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).