About dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate
dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate (PubChem CID 6736693) has the molecular formula C19H26N2O4
and a molecular weight of 346.43 g/mol. Its IUPAC name is dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate.
Molecular Properties
| Compound Name | dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate |
| PubChem CID | 6736693 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate |
| SMILES | CCCCCCC#CCCOC(=O)NNC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H26N2O4/c1-3-4-5-6-7-8-9-10-15-25-19(23)21-20-18(22)16-11-13-17(24-2)14-12-16/h11-14H,3-7,10,15H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | MIKZYNNCCQDMMP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate?
The IUPAC name of dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate (CID 6736693) is dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate.
What is the SMILES notation for dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate?
The canonical SMILES for dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate is CCCCCCC#CCCOC(=O)NNC(=O)c1ccc(OC)cc1.
What is the InChIKey of dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate?
The InChIKey is MIKZYNNCCQDMMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O4/c1-3-4-5-6-7-8-9-10-15-25-19(23)21-20-18(22)16-11-13-17(24-2)14-12-16/h11-14H,3-7,10,15H2,1-2H3,(H,20,22)(H,21,23).
What are the key properties of dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate?
dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate has a molecular weight of 346.43 g/mol, XLogP of 3.43, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dec-3-ynyl N-[(4-methoxybenzoyl)amino]carbamate is sourced from PubChem (CID 6736693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).