C18H17IO5 — CID 67378939
(4-iodo-2-methoxycarbonyl-6-methylphenyl) 2-hydroxy-3,4-dimethylbenzoate (PubChem CID 67378939) has the molecular formula C18H17IO5 and a molecular weight of 440.23 g/mol. Its IUPAC name is (4-iodo-2-methoxycarbonyl-6-methylphenyl) 2-hydroxy-3,4-dimethylbenzoate.
| Compound Name | (4-iodo-2-methoxycarbonyl-6-methylphenyl) 2-hydroxy-3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 67378939 |
| Molecular Formula | C18H17IO5 |
| Molecular Weight | 440.23 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | (4-iodo-2-methoxycarbonyl-6-methylphenyl) 2-hydroxy-3,4-dimethylbenzoate |
| SMILES | COC(=O)c1cc(I)cc(C)c1OC(=O)c1ccc(C)c(C)c1O |
| InChI | InChI=1S/C18H17IO5/c1-9-5-6-13(15(20)11(9)3)18(22)24-16-10(2)7-12(19)8-14(16)17(21)23-4/h5-8,20H,1-4H3 |
| InChIKey | VIGYACUIOKOZMB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|