C14H20O8 — CID 67384508
butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid (PubChem CID 67384508) has the molecular formula C14H20O8 and a molecular weight of 316.31 g/mol. Its IUPAC name is butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid.
| Compound Name | butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 67384508 |
| Molecular Formula | C14H20O8 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid |
| SMILES | CCCCOC(=O)C1=CC(=O)CC(C)(C)O1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H18O4.C2H2O4/c1-4-5-6-15-11(14)10-7-9(13)8-12(2,3)16-10;3-1(4)2(5)6/h7H,4-6,8H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | FNXLPEZBZHLRMC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|