butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid

C14H20O8 — CID 67384508

IUPACbutyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid
SMILESCCCCOC(=O)C1=CC(=O)CC(C)(C)O1.O=C(O)C(=O)O
InChIInChI=1S/C12H18O4.C2H2O4/c1-4-5-6-15-11(14)10-7-9(13)8-12(2,3)16-10;3-1(4)2(5)6/h7H,4-6,8H2,1-3H3;(H,3,4)(H,5,6)
InChIKeyFNXLPEZBZHLRMC-UHFFFAOYSA-N
MW316.31 g/mol
LogP1.14
Rot. Bonds4

About butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid

butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid (PubChem CID 67384508) has the molecular formula C14H20O8 and a molecular weight of 316.31 g/mol. Its IUPAC name is butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid.

Molecular Properties

Compound Namebutyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid
PubChem CID67384508
Molecular FormulaC14H20O8
Molecular Weight316.31 g/mol
Exact Mass316.12
IUPAC Namebutyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid
SMILESCCCCOC(=O)C1=CC(=O)CC(C)(C)O1.O=C(O)C(=O)O
InChIInChI=1S/C12H18O4.C2H2O4/c1-4-5-6-15-11(14)10-7-9(13)8-12(2,3)16-10;3-1(4)2(5)6/h7H,4-6,8H2,1-3H3;(H,3,4)(H,5,6)
InChIKeyFNXLPEZBZHLRMC-UHFFFAOYSA-N
XLogP1.14
TPSA127.20 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.31
LogP ≤ 51.14
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid?
The IUPAC name of butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid (CID 67384508) is butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid.
What is the SMILES notation for butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid?
The canonical SMILES for butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid is CCCCOC(=O)C1=CC(=O)CC(C)(C)O1.O=C(O)C(=O)O.
What is the InChIKey of butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid?
The InChIKey is FNXLPEZBZHLRMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4.C2H2O4/c1-4-5-6-15-11(14)10-7-9(13)8-12(2,3)16-10;3-1(4)2(5)6/h7H,4-6,8H2,1-3H3;(H,3,4)(H,5,6).
What are the key properties of butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid?
butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid has a molecular weight of 316.31 g/mol, XLogP of 1.14, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate;oxalic acid is sourced from PubChem (CID 67384508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).