C26H21F3N2O3 — CID 67385235
methyl 2-[(4-pyridin-2-ylphenyl)methyl-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]prop-2-enoate (PubChem CID 67385235) has the molecular formula C26H21F3N2O3 and a molecular weight of 466.46 g/mol. Its IUPAC name is methyl 2-[(4-pyridin-2-ylphenyl)methyl-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]prop-2-enoate.
| Compound Name | methyl 2-[(4-pyridin-2-ylphenyl)methyl-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 67385235 |
| Molecular Formula | C26H21F3N2O3 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | methyl 2-[(4-pyridin-2-ylphenyl)methyl-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]amino]prop-2-enoate |
| SMILES | C=C(C(=O)OC)N(Cc1ccc(-c2ccccn2)cc1)C(=O)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H21F3N2O3/c1-18(25(33)34-2)31(17-20-6-11-21(12-7-20)23-5-3-4-16-30-23)24(32)15-10-19-8-13-22(14-9-19)26(27,28)29/h3-16H,1,17H2,2H3/b15-10+ |
| InChIKey | TVLPTYHHCUUEON-XNTDXEJSSA-N |
| XLogP | 5.50 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|