C16H24N2O2S — CID 67385624
methyl (E)-3-[3-amino-4-[2-(diethylamino)ethylsulfanyl]phenyl]prop-2-enoate (PubChem CID 67385624) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is methyl (E)-3-[3-amino-4-[2-(diethylamino)ethylsulfanyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-amino-4-[2-(diethylamino)ethylsulfanyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67385624 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | methyl (E)-3-[3-amino-4-[2-(diethylamino)ethylsulfanyl]phenyl]prop-2-enoate |
| SMILES | CCN(CC)CCSc1ccc(/C=C/C(=O)OC)cc1N |
| InChI | InChI=1S/C16H24N2O2S/c1-4-18(5-2)10-11-21-15-8-6-13(12-14(15)17)7-9-16(19)20-3/h6-9,12H,4-5,10-11,17H2,1-3H3/b9-7+ |
| InChIKey | KUGUMDBMCMOGQV-VQHVLOKHSA-N |
| XLogP | 2.89 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|