C22H36N4O2S2 — CID 72544404
(E)-3-[4-[2-(diethylamino)ethylsulfanyl]-3-(hexylcarbamothioylamino)phenyl]-N-hydroxyprop-2-enamide (PubChem CID 72544404) has the molecular formula C22H36N4O2S2 and a molecular weight of 452.69 g/mol. Its IUPAC name is (E)-3-[4-[2-(diethylamino)ethylsulfanyl]-3-(hexylcarbamothioylamino)phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[4-[2-(diethylamino)ethylsulfanyl]-3-(hexylcarbamothioylamino)phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 72544404 |
| Molecular Formula | C22H36N4O2S2 |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | (E)-3-[4-[2-(diethylamino)ethylsulfanyl]-3-(hexylcarbamothioylamino)phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CCCCCCNC(=S)Nc1cc(/C=C/C(=O)NO)ccc1SCCN(CC)CC |
| InChI | InChI=1S/C22H36N4O2S2/c1-4-7-8-9-14-23-22(29)24-19-17-18(11-13-21(27)25-28)10-12-20(19)30-16-15-26(5-2)6-3/h10-13,17,28H,4-9,14-16H2,1-3H3,(H,25,27)(H2,23,24,29)/b13-11+ |
| InChIKey | HCCOQPTXDWDSRC-ACCUITESSA-N |
| XLogP | 4.51 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|