C20H31N3O3S — CID 72544854
methyl (E)-3-[4-[2-(diethylamino)ethoxy]-3-(propylcarbamothioylamino)phenyl]prop-2-enoate (PubChem CID 72544854) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is methyl (E)-3-[4-[2-(diethylamino)ethoxy]-3-(propylcarbamothioylamino)phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[2-(diethylamino)ethoxy]-3-(propylcarbamothioylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 72544854 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | methyl (E)-3-[4-[2-(diethylamino)ethoxy]-3-(propylcarbamothioylamino)phenyl]prop-2-enoate |
| SMILES | CCCNC(=S)Nc1cc(/C=C/C(=O)OC)ccc1OCCN(CC)CC |
| InChI | InChI=1S/C20H31N3O3S/c1-5-12-21-20(27)22-17-15-16(9-11-19(24)25-4)8-10-18(17)26-14-13-23(6-2)7-3/h8-11,15H,5-7,12-14H2,1-4H3,(H2,21,22,27)/b11-9+ |
| InChIKey | ATUNXINLKNBZBY-PKNBQFBNSA-N |
| XLogP | 3.29 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|