C14H21ClN2O2 — CID 67386202
benzyl (3R,5R)-3-amino-5-methylpiperidine-1-carboxylate;hydrochloride (PubChem CID 67386202) has the molecular formula C14H21ClN2O2 and a molecular weight of 284.79 g/mol. Its IUPAC name is benzyl (3R,5R)-3-amino-5-methylpiperidine-1-carboxylate;hydrochloride.
| Compound Name | benzyl (3R,5R)-3-amino-5-methylpiperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 67386202 |
| Molecular Formula | C14H21ClN2O2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | benzyl (3R,5R)-3-amino-5-methylpiperidine-1-carboxylate;hydrochloride |
| SMILES | C[C@@H]1C[C@@H](N)CN(C(=O)OCc2ccccc2)C1.Cl |
| InChI | InChI=1S/C14H20N2O2.ClH/c1-11-7-13(15)9-16(8-11)14(17)18-10-12-5-3-2-4-6-12;/h2-6,11,13H,7-10,15H2,1H3;1H/t11-,13-;/m1./s1 |
| InChIKey | ONHUQYBMESJGDA-LOCPCMAASA-N |
| XLogP | 2.41 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |