C19H22O7 — CID 67395118
5-methoxycarbonylhexa-2,5-dienoic acid;2-methylidene-4-phenoxybutanoic acid (PubChem CID 67395118) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is 5-methoxycarbonylhexa-2,5-dienoic acid;2-methylidene-4-phenoxybutanoic acid.
| Compound Name | 5-methoxycarbonylhexa-2,5-dienoic acid;2-methylidene-4-phenoxybutanoic acid |
|---|---|
| PubChem CID | 67395118 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 5-methoxycarbonylhexa-2,5-dienoic acid;2-methylidene-4-phenoxybutanoic acid |
| SMILES | C=C(CC=CC(=O)O)C(=O)OC.C=C(CCOc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H12O3.C8H10O4/c1-9(11(12)13)7-8-14-10-5-3-2-4-6-10;1-6(8(11)12-2)4-3-5-7(9)10/h2-6H,1,7-8H2,(H,12,13);3,5H,1,4H2,2H3,(H,9,10) |
| InChIKey | SNZLBAHRHGGUQU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|