C27H37ClN2OS — CID 67400032
6-[1-[3-chloro-4-[3-(diethylamino)propylsulfanyl]phenyl]-2-cyclopentylethenyl]-3-ethyl-1H-pyridin-2-one (PubChem CID 67400032) has the molecular formula C27H37ClN2OS and a molecular weight of 473.13 g/mol. Its IUPAC name is 6-[1-[3-chloro-4-[3-(diethylamino)propylsulfanyl]phenyl]-2-cyclopentylethenyl]-3-ethyl-1H-pyridin-2-one.
| Compound Name | 6-[1-[3-chloro-4-[3-(diethylamino)propylsulfanyl]phenyl]-2-cyclopentylethenyl]-3-ethyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 67400032 |
| Molecular Formula | C27H37ClN2OS |
| Molecular Weight | 473.13 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 6-[1-[3-chloro-4-[3-(diethylamino)propylsulfanyl]phenyl]-2-cyclopentylethenyl]-3-ethyl-1H-pyridin-2-one |
| SMILES | CCc1ccc(C(=CC2CCCC2)c2ccc(SCCCN(CC)CC)c(Cl)c2)[nH]c1=O |
| InChI | InChI=1S/C27H37ClN2OS/c1-4-21-12-14-25(29-27(21)31)23(18-20-10-7-8-11-20)22-13-15-26(24(28)19-22)32-17-9-16-30(5-2)6-3/h12-15,18-20H,4-11,16-17H2,1-3H3,(H,29,31) |
| InChIKey | WYTGEUXUQMIJQV-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.13 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|