C25H35NO4Si — CID 67400841
[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-(5-cyclopropyl-6-methoxy-2-pyridinyl)methanone (PubChem CID 67400841) has the molecular formula C25H35NO4Si and a molecular weight of 441.64 g/mol. Its IUPAC name is [4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-(5-cyclopropyl-6-methoxy-2-pyridinyl)methanone.
| Compound Name | [4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-(5-cyclopropyl-6-methoxy-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 67400841 |
| Molecular Formula | C25H35NO4Si |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | [4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]phenyl]-(5-cyclopropyl-6-methoxy-2-pyridinyl)methanone |
| SMILES | COc1nc(C(=O)c2ccc(OCCCO[Si](C)(C)C(C)(C)C)cc2)ccc1C1CC1 |
| InChI | InChI=1S/C25H35NO4Si/c1-25(2,3)31(5,6)30-17-7-16-29-20-12-10-19(11-13-20)23(27)22-15-14-21(18-8-9-18)24(26-22)28-4/h10-15,18H,7-9,16-17H2,1-6H3 |
| InChIKey | UXLCNNMVHFDESK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|