C8H7N3O — CID 67416750
4-[2-(1H-imidazol-5-yl)ethenyl]-1,2-oxazole (PubChem CID 67416750) has the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. Its IUPAC name is 4-[2-(1H-imidazol-5-yl)ethenyl]-1,2-oxazole.
| Compound Name | 4-[2-(1H-imidazol-5-yl)ethenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 67416750 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 4-[2-(1H-imidazol-5-yl)ethenyl]-1,2-oxazole |
| SMILES | C(=Cc1cnc[nH]1)c1cnoc1 |
| InChI | InChI=1S/C8H7N3O/c1(7-3-11-12-5-7)2-8-4-9-6-10-8/h1-6H,(H,9,10) |
| InChIKey | SEPVYRQGNKMYTL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |