C27H27Cl2NO3 — CID 67419673
[1-[(4-chlorobenzoyl)amino]-5-methyl-2-phenylhexan-3-yl] 4-chlorobenzoate (PubChem CID 67419673) has the molecular formula C27H27Cl2NO3 and a molecular weight of 484.42 g/mol. Its IUPAC name is [1-[(4-chlorobenzoyl)amino]-5-methyl-2-phenylhexan-3-yl] 4-chlorobenzoate.
| Compound Name | [1-[(4-chlorobenzoyl)amino]-5-methyl-2-phenylhexan-3-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 67419673 |
| Molecular Formula | C27H27Cl2NO3 |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | [1-[(4-chlorobenzoyl)amino]-5-methyl-2-phenylhexan-3-yl] 4-chlorobenzoate |
| SMILES | CC(C)CC(OC(=O)c1ccc(Cl)cc1)C(CNC(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H27Cl2NO3/c1-18(2)16-25(33-27(32)21-10-14-23(29)15-11-21)24(19-6-4-3-5-7-19)17-30-26(31)20-8-12-22(28)13-9-20/h3-15,18,24-25H,16-17H2,1-2H3,(H,30,31) |
| InChIKey | DIPACNIWNUFHNF-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |